Products 1520-42-9
CAS 1520-42-9 is the registry number for Benzene,1,1',1''-(1-ethanyl-2-ylidene)tris-. Offered by: Chemat. Available pack sizes: 50mg.
1,2-diphenylethylbenzene (CAS 1520-42-9) is a chemical compound with the molecular formula C20H18 and a molecular weight of 258.4 g/mol. IUPAC name: 1,2-diphenylethylbenzene. InChIKey: KIIBETRYVBIAOO-UHFFFAOYSA-N.
| Molecular formula | C20H18 |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | 1,2-diphenylethylbenzene |
| InChIKey | KIIBETRYVBIAOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
1,1,2-Triphenylethane, Ethane-1,1,2-triyltribenzene, Ethane, 1,1,2-triphenyl-, Benzene, 1,1',1''-(1-ethanyl-2-ylidene)tris-, 1,2-diphenylethylbenzene, 1,2-Triphenylethane, Ethane,1,2-triphenyl-, (1,2-Diphenylethyl)benzene #, KIIBETRYVBIAOO-UHFFFAOYSA-N, 1,1',1''-(Ethane-1,1,2-triyl)tribenzene