Products 2098198-51-5
CAS 2098198-51-5 appears in our catalog under these names: Levodropropizine Impurity 1, (S)-(-)-Dropropizine N,N-Dioxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
(2S)-3-(1,4-dioxido-4-phenylpiperazine-1,4-diium-1-yl)propane-1,2-diol (CAS 2098198-51-5) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: (2S)-3-(1,4-dioxido-4-phenylpiperazine-1,4-diium-1-yl)propane-1,2-diol. InChIKey: ORQHBRZAGJIZCU-NFOMZHRRSA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (2S)-3-(1,4-dioxido-4-phenylpiperazine-1,4-diium-1-yl)propane-1,2-diol |
| InChIKey | ORQHBRZAGJIZCU-NFOMZHRRSA-N |
| SMILES | C1C[N+](CC[N+]1(C[C@@H](CO)O)[O-])(C2=CC=CC=C2)[O-] |
Computed by PubChem (NCBI)