Products 1523001-59-3

CAS 1523001-59-3 is the registry number for Ethyl 2-(1-methyl-1H-pyrazol-5-yl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-methylpyrazol-3-yl)-2-oxoacetate (CAS 1523001-59-3) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: ethyl 2-(2-methylpyrazol-3-yl)-2-oxoacetate. InChIKey: OLMUNWKKSMIJQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O3
Molecular weight182.18 g/mol
IUPAC nameethyl 2-(2-methylpyrazol-3-yl)-2-oxoacetate
InChIKeyOLMUNWKKSMIJQJ-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)C1=CC=NN1C

Computed by PubChem (NCBI)