CAS 1523391-72-1 appears in our catalog under these names: 2-(2,3-Dihydro-1-benzofuran-5-yl)ethane-1-sulfonyl chloride, 2-(2,3-Dihydro-1-benzofuran-5-yl)ethane-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-(2,3-dihydro-1-benzofuran-5-yl)ethanesulfonyl chloride (CAS 1523391-72-1) is a chemical compound with the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. IUPAC name: 2-(2,3-dihydro-1-benzofuran-5-yl)ethanesulfonyl chloride. InChIKey: QSMPCCSLJVXVBY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 2-(2,3-dihydro-1-benzofuran-5-yl)ethanesulfonyl chloride |
| InChIKey | QSMPCCSLJVXVBY-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)CCS(=O)(=O)Cl |
Computed by PubChem (NCBI)