CAS 88040-92-0 is the registry number for 6-Methoxy-2,3-dihydro-1h-indene-5-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
6-methoxy-2,3-dihydro-1H-indene-5-sulfonyl chloride (CAS 88040-92-0) is a chemical compound with the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. IUPAC name: 6-methoxy-2,3-dihydro-1H-indene-5-sulfonyl chloride. InChIKey: SJOLEHYHMOBNIB-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 6-methoxy-2,3-dihydro-1H-indene-5-sulfonyl chloride |
| InChIKey | SJOLEHYHMOBNIB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CCCC2=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)