Products 87254-52-2

CAS 87254-52-2 appears in our catalog under these names: 2,2-Dimethyl-2,3-dihydrobenzofuran-7-sulfonyl chloride, 97%, 2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride (CAS 87254-52-2) is a chemical compound with the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. IUPAC name: 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride. InChIKey: RVJAQMKTLLXHTD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO3S
Molecular weight246.71 g/mol
IUPAC name2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride
InChIKeyRVJAQMKTLLXHTD-UHFFFAOYSA-N
SMILESCC1(CC2=C(O1)C(=CC=C2)S(=O)(=O)Cl)C

Computed by PubChem (NCBI)