CAS 87254-52-2 appears in our catalog under these names: 2,2-Dimethyl-2,3-dihydrobenzofuran-7-sulfonyl chloride, 97%, 2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride (CAS 87254-52-2) is a chemical compound with the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. IUPAC name: 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride. InChIKey: RVJAQMKTLLXHTD-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride |
| InChIKey | RVJAQMKTLLXHTD-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)