CAS 1784843-92-0 is the registry number for (3,4-Dihydro-1H-2-benzopyran-6-yl)methanesulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3,4-dihydro-1H-isochromen-6-ylmethanesulfonyl chloride (CAS 1784843-92-0) is a chemical compound with the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. IUPAC name: 3,4-dihydro-1H-isochromen-6-ylmethanesulfonyl chloride. InChIKey: LCWIFORZNSRHFL-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 3,4-dihydro-1H-isochromen-6-ylmethanesulfonyl chloride |
| InChIKey | LCWIFORZNSRHFL-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C=C(C=C2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)