CAS 91077-12-2 is the registry number for Ethyl 2–((4–chlorophenyl)sulfinyl)acetate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Ethyl 2-(4-chlorophenyl)sulfinylacetate (CAS 91077-12-2) is a chemical compound with the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. IUPAC name: ethyl 2-(4-chlorophenyl)sulfinylacetate. InChIKey: AWLUBZLGOYLMQT-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | ethyl 2-(4-chlorophenyl)sulfinylacetate |
| InChIKey | AWLUBZLGOYLMQT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CS(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)