CAS 181997-72-8 appears in our catalog under these names: 1-(2-Chloro-4-methanesulfonyl-3-methyl-phenyl)-ethanone, 95%, 1–(2–Chloro–3–methyl–4–(methylsulfonyl)phenyl)ethanone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-(2-chloro-3-methyl-4-methylsulfonylphenyl)ethanone (CAS 181997-72-8) is a chemical compound with the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. IUPAC name: 1-(2-chloro-3-methyl-4-methylsulfonylphenyl)ethanone. InChIKey: KLJPFWVJHXRIPL-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 1-(2-chloro-3-methyl-4-methylsulfonylphenyl)ethanone |
| InChIKey | KLJPFWVJHXRIPL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)C(=O)C)S(=O)(=O)C |
Computed by PubChem (NCBI)