CAS 1528607-78-4 appears in our catalog under these names: 1–(4–Bromo–3,5–difluorophenyl)ethanone, 4'-BROMO-3',5'-DIFLUOROACETOPHENONE, 96%, 4'-BROMO-3',5'-DIFLUOROACETOPHENONE, 96%, 96%, 1-(4-Bromo-3,5-difluorophenyl)ethanone, 98%. Offered by: GLPBio, Fluorochem, Chemat, Ambeed. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 250mg.
1-(4-bromo-3,5-difluorophenyl)ethanone (CAS 1528607-78-4) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(4-bromo-3,5-difluorophenyl)ethanone. InChIKey: VAOKHDWJQCHTID-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(4-bromo-3,5-difluorophenyl)ethanone |
| InChIKey | VAOKHDWJQCHTID-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)F)Br)F |
Computed by PubChem (NCBI)