Products 1528768-32-2
CAS 1528768-32-2 is the registry number for Plasiaticine B. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(3R)-3,5-dihydroxy-2-oxo-1H-indol-3-yl]acetonitrile (CAS 1528768-32-2) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 2-[(3R)-3,5-dihydroxy-2-oxo-1H-indol-3-yl]acetonitrile. InChIKey: WRDLUURRJKWDSQ-SNVBAGLBSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 2-[(3R)-3,5-dihydroxy-2-oxo-1H-indol-3-yl]acetonitrile |
| InChIKey | WRDLUURRJKWDSQ-SNVBAGLBSA-N |
| SMILES | C1=CC2=C(C=C1O)[C@@](C(=O)N2)(CC#N)O |
Computed by PubChem (NCBI)
Synonyms:
Plasiaticine B, orb2695098