CAS 153186-67-5 is the registry number for rac-(5R,6R)-6-(Furan-2-yl)-5-nitropiperidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5R,6R)-6-(furan-2-yl)-5-nitropiperidin-2-one (CAS 153186-67-5) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (5R,6R)-6-(furan-2-yl)-5-nitropiperidin-2-one. InChIKey: XGPOTQVNDBYTKG-HZGVNTEJSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (5R,6R)-6-(furan-2-yl)-5-nitropiperidin-2-one |
| InChIKey | XGPOTQVNDBYTKG-HZGVNTEJSA-N |
| SMILES | C1CC(=O)N[C@H]([C@@H]1[N+](=O)[O-])C2=CC=CO2 |
Computed by PubChem (NCBI)