Products 1533457-61-2
CAS 1533457-61-2 is the registry number for 4-Nitro-1-naphthalenyl 2,2-dimethylpropanoate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-nitronaphthalen-1-yl) 2,2-dimethylpropanoate (CAS 1533457-61-2) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: (4-nitronaphthalen-1-yl) 2,2-dimethylpropanoate. InChIKey: ACGLUTLEVCJVAN-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | (4-nitronaphthalen-1-yl) 2,2-dimethylpropanoate |
| InChIKey | ACGLUTLEVCJVAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C2=CC=CC=C21)[N+](=O)[O-] |
Computed by PubChem (NCBI)