CAS 153504-80-4 is the registry number for 5-Bromo-7-fluoro-1,4-dihydroquinoxaline-2,3-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
5-bromo-7-fluoro-1,4-dihydroquinoxaline-2,3-dione (CAS 153504-80-4) is a chemical compound with the molecular formula C8H4BrFN2O2 and a molecular weight of 259.03 g/mol. IUPAC name: 5-bromo-7-fluoro-1,4-dihydroquinoxaline-2,3-dione. InChIKey: DWZQVTQJIMJXCZ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 5-bromo-7-fluoro-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | DWZQVTQJIMJXCZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C(=O)N2)Br)F |
Computed by PubChem (NCBI)