Products 1807211-69-3
CAS 1807211-69-3 is the registry number for 2-(5-Bromo-3-fluoro-2-nitrophenyl)acetonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(5-bromo-3-fluoro-2-nitrophenyl)acetonitrile (CAS 1807211-69-3) is a chemical compound with the molecular formula C8H4BrFN2O2 and a molecular weight of 259.03 g/mol. IUPAC name: 2-(5-bromo-3-fluoro-2-nitrophenyl)acetonitrile. InChIKey: VLKWBFAPZRQLNG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 2-(5-bromo-3-fluoro-2-nitrophenyl)acetonitrile |
| InChIKey | VLKWBFAPZRQLNG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CC#N)[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)