CAS 1598299-96-7 is the registry number for 6-bromo-7-fluoro-1,3-dihydroquinazoline-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-bromo-7-fluoro-1H-quinazoline-2,4-dione (CAS 1598299-96-7) is a chemical compound with the molecular formula C8H4BrFN2O2 and a molecular weight of 259.03 g/mol. IUPAC name: 6-bromo-7-fluoro-1H-quinazoline-2,4-dione. InChIKey: JWFMSUPGXRWFKF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 6-bromo-7-fluoro-1H-quinazoline-2,4-dione |
| InChIKey | JWFMSUPGXRWFKF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)F)NC(=O)NC2=O |
Computed by PubChem (NCBI)