CAS 2765352-55-2 is the registry number for 7-Bromo-8-fluoroquinazoline-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-8-fluoro-1H-quinazoline-2,4-dione (CAS 2765352-55-2) is a chemical compound with the molecular formula C8H4BrFN2O2 and a molecular weight of 259.03 g/mol. IUPAC name: 7-bromo-8-fluoro-1H-quinazoline-2,4-dione. InChIKey: CJXZYJMCMOYEKA-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 7-bromo-8-fluoro-1H-quinazoline-2,4-dione |
| InChIKey | CJXZYJMCMOYEKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)NC(=O)N2)F)Br |
Computed by PubChem (NCBI)