Products 885520-62-7
CAS 885520-62-7 appears in our catalog under these names: 6-Bromo-4-fluoro-1H-indazole-3-carboxylic acid, 95%, 95%, 6-Bromo-4-fluoro-1H-indazole-3-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
6-bromo-4-fluoro-1H-indazole-3-carboxylic acid (CAS 885520-62-7) is a chemical compound with the molecular formula C8H4BrFN2O2 and a molecular weight of 259.03 g/mol. IUPAC name: 6-bromo-4-fluoro-1H-indazole-3-carboxylic acid. InChIKey: CCPDJXSRIPZFSY-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 6-bromo-4-fluoro-1H-indazole-3-carboxylic acid |
| InChIKey | CCPDJXSRIPZFSY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2C(=O)O)F)Br |
Computed by PubChem (NCBI)