Products 885522-01-0
CAS 885522-01-0 appears in our catalog under these names: 3-Bromo-6-fluoro-1h-indazole-4-carboxylic acid, 95%, 3-Bromo-6-fluoro-1H-indazole-4-carboxylic acid, 95+%, 3–Bromo–6–fluoro–1H–indazole–4–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromo-6-fluoro-2H-indazole-4-carboxylic acid (CAS 885522-01-0) is a chemical compound with the molecular formula C8H4BrFN2O2 and a molecular weight of 259.03 g/mol. IUPAC name: 3-bromo-6-fluoro-2H-indazole-4-carboxylic acid. InChIKey: HVKZOBUDXONMCS-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 3-bromo-6-fluoro-2H-indazole-4-carboxylic acid |
| InChIKey | HVKZOBUDXONMCS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C(NN=C21)Br)C(=O)O)F |
Computed by PubChem (NCBI)