CAS 1536079-50-1 is the registry number for (±)-MDMA-13C6 Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine;hydrochloride (CAS 1536079-50-1) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine;hydrochloride. InChIKey: LUWHVONVCYWRMZ-GUDWOQMWSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine;hydrochloride |
| InChIKey | LUWHVONVCYWRMZ-GUDWOQMWSA-N |
| SMILES | CC(C[13C]1=[13CH][13C]2=[13C]([13CH]=[13CH]1)OCO2)NC.Cl |
Computed by PubChem (NCBI)