CAS 17841-69-9 appears in our catalog under these names: 4-(Aminomethyl)phenylacetic acid ethyl ester hydrochloride, 95%, Ethyl 2-(4-(aminomethyl)phenyl)acetate hydrochloride, 98%, Ethyl 4-(aminomethyl)phenylacetate hydrochloride, Ethyl 2-(4-(aminomethyl)phenyl)acetate hydrochloride, 98%, 98%, Ethyl 2-(4-(aminomethyl)phenyl)acetatehydrochloride, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g, 25g.
Ethyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride (CAS 17841-69-9) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: ethyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride. InChIKey: SSXOEPBHTWEJLZ-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | ethyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride |
| InChIKey | SSXOEPBHTWEJLZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)