CAS 69558-32-3 appears in our catalog under these names: (S)-(+)-MDMA Hydrochloride, (S)–(+)–3,4–MDMA (hydrochloride). Offered by: TRC, GLPBio. Available pack sizes: 50mg, 1mg.
(2S)-1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine;hydrochloride (CAS 69558-32-3) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (2S)-1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine;hydrochloride. InChIKey: LUWHVONVCYWRMZ-QRPNPIFTSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (2S)-1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine;hydrochloride |
| InChIKey | LUWHVONVCYWRMZ-QRPNPIFTSA-N |
| SMILES | C[C@@H](CC1=CC2=C(C=C1)OCO2)NC.Cl |
Computed by PubChem (NCBI)