CAS 1537863-81-2 is the registry number for 3-Phenyl-1,4,5-oxathiazepane 4,4-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-phenyl-1,4,5-oxathiazepane 4,4-dioxide (CAS 1537863-81-2) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 3-phenyl-1,4,5-oxathiazepane 4,4-dioxide. InChIKey: HRVVRSSZTMSNNY-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 3-phenyl-1,4,5-oxathiazepane 4,4-dioxide |
| InChIKey | HRVVRSSZTMSNNY-UHFFFAOYSA-N |
| SMILES | C1COCC(S(=O)(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)