Products 1537863-81-2

CAS 1537863-81-2 is the registry number for 3-Phenyl-1,4,5-oxathiazepane 4,4-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-phenyl-1,4,5-oxathiazepane 4,4-dioxide (CAS 1537863-81-2) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 3-phenyl-1,4,5-oxathiazepane 4,4-dioxide. InChIKey: HRVVRSSZTMSNNY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO3S
Molecular weight227.28 g/mol
IUPAC name3-phenyl-1,4,5-oxathiazepane 4,4-dioxide
InChIKeyHRVVRSSZTMSNNY-UHFFFAOYSA-N
SMILESC1COCC(S(=O)(=O)N1)C2=CC=CC=C2

Computed by PubChem (NCBI)