Products 1538445-96-3
CAS 1538445-96-3 is the registry number for 2,4-Dichloro-8,8-dimethyl-5,6,7,8-tetrahydroquinazoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4-dichloro-8,8-dimethyl-6,7-dihydro-5H-quinazoline (CAS 1538445-96-3) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 2,4-dichloro-8,8-dimethyl-6,7-dihydro-5H-quinazoline. InChIKey: PCBRUJALJWOQSU-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 2,4-dichloro-8,8-dimethyl-6,7-dihydro-5H-quinazoline |
| InChIKey | PCBRUJALJWOQSU-UHFFFAOYSA-N |
| SMILES | CC1(CCCC2=C1N=C(N=C2Cl)Cl)C |
Computed by PubChem (NCBI)