CAS 153886-68-1 is the registry number for Argatroban Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-1,2,3,4-tetrahydroquinoline-8-sulfonic acid (CAS 153886-68-1) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 3-methyl-1,2,3,4-tetrahydroquinoline-8-sulfonic acid. InChIKey: HDGVSYYMMRPVBX-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 3-methyl-1,2,3,4-tetrahydroquinoline-8-sulfonic acid |
| InChIKey | HDGVSYYMMRPVBX-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(=CC=C2)S(=O)(=O)O)NC1 |
Computed by PubChem (NCBI)