CAS 1539774-98-5 is the registry number for 5-cyclopentyl-2-fluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-cyclopentyl-2-fluorobenzoic acid (CAS 1539774-98-5) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 5-cyclopentyl-2-fluorobenzoic acid. InChIKey: WSEGWAXNAYTNKT-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 5-cyclopentyl-2-fluorobenzoic acid |
| InChIKey | WSEGWAXNAYTNKT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=CC(=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)