CAS 1539944-12-1 appears in our catalog under these names: 4-Chloro-2-(2-chlorophenyl)aniline, 95%, 4-Chloro-2-(2-chlorophenyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-chloro-2-(2-chlorophenyl)aniline (CAS 1539944-12-1) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 4-chloro-2-(2-chlorophenyl)aniline. InChIKey: BZHXWNBXAGEMKH-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 4-chloro-2-(2-chlorophenyl)aniline |
| InChIKey | BZHXWNBXAGEMKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C=CC(=C2)Cl)N)Cl |
Computed by PubChem (NCBI)