Products 1541391-51-8
CAS 1541391-51-8 appears in our catalog under these names: 3-(Quinolin-5-yl)propanoic acid, 95%, 5-Quinolinepropanoic acid, 98%, 98%, 5-Quinolinepropanoic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-quinolin-5-ylpropanoic acid (CAS 1541391-51-8) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 3-quinolin-5-ylpropanoic acid. InChIKey: ZYPNJYVATBRGFQ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 3-quinolin-5-ylpropanoic acid |
| InChIKey | ZYPNJYVATBRGFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=NC2=C1)CCC(=O)O |
Computed by PubChem (NCBI)