Products 154235-77-5
CAS 154235-77-5 appears in our catalog under these names: 1,3-Benzoxazole-6-carboxylic acid/ 97%, 1,3–Benzoxazole–6–carboxylic acid, Serpin B9-IN-1 97%, Benzo[d]oxazole-6-carboxylic acid, 98%, 98%, Serpin B9-IN-1, 98.0%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 200mg, 5g, 250mg, 1g, 25g, 100mg, 10g, 1 g.
1,3-benzoxazole-6-carboxylic acid (CAS 154235-77-5) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 1,3-benzoxazole-6-carboxylic acid. InChIKey: FRNTUFQKHQMLSE-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1,3-benzoxazole-6-carboxylic acid |
| InChIKey | FRNTUFQKHQMLSE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC=N2 |
Computed by PubChem (NCBI)