CAS 15432-24-3 is the registry number for 2-(Pyridin-3-yl)-1H-indole. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-pyridin-3-yl-1H-indole (CAS 15432-24-3) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-pyridin-3-yl-1H-indole. InChIKey: KDWAJWXWMMNKHA-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-pyridin-3-yl-1H-indole |
| InChIKey | KDWAJWXWMMNKHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)