CAS 154435-36-6 is the registry number for 3,6-Diisobutylphthalonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-bis(2-methylpropyl)benzene-1,2-dicarbonitrile (CAS 154435-36-6) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 3,6-bis(2-methylpropyl)benzene-1,2-dicarbonitrile. InChIKey: JNHMJTKDMBQXKQ-UHFFFAOYSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 3,6-bis(2-methylpropyl)benzene-1,2-dicarbonitrile |
| InChIKey | JNHMJTKDMBQXKQ-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=C(C(=C(C=C1)CC(C)C)C#N)C#N |
Computed by PubChem (NCBI)