CAS 154523-35-0 is the registry number for 7,7-Dimethyl-7H-benzo[c]fluoren-5-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,7-dimethylbenzo[c]fluoren-5-ol (CAS 154523-35-0) is a chemical compound with the molecular formula C19H16O and a molecular weight of 260.3 g/mol. IUPAC name: 7,7-dimethylbenzo[c]fluoren-5-ol. InChIKey: JPMYPXRQMIBJJJ-UHFFFAOYSA-N.
| Molecular formula | C19H16O |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 7,7-dimethylbenzo[c]fluoren-5-ol |
| InChIKey | JPMYPXRQMIBJJJ-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C4=CC=CC=C43)O)C |
Computed by PubChem (NCBI)