Products 76324-23-7

CAS 76324-23-7 is the registry number for Biphenyl-4-yl m-tolyl ether, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

1-methyl-3-(4-phenylphenoxy)benzene (CAS 76324-23-7) is a chemical compound with the molecular formula C19H16O and a molecular weight of 260.3 g/mol. IUPAC name: 1-methyl-3-(4-phenylphenoxy)benzene. InChIKey: XKYZHTGHCYULMR-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16O
Molecular weight260.3 g/mol
IUPAC name1-methyl-3-(4-phenylphenoxy)benzene
InChIKeyXKYZHTGHCYULMR-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)OC2=CC=C(C=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)