CAS 76324-23-7 is the registry number for Biphenyl-4-yl m-tolyl ether, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1-methyl-3-(4-phenylphenoxy)benzene (CAS 76324-23-7) is a chemical compound with the molecular formula C19H16O and a molecular weight of 260.3 g/mol. IUPAC name: 1-methyl-3-(4-phenylphenoxy)benzene. InChIKey: XKYZHTGHCYULMR-UHFFFAOYSA-N.
| Molecular formula | C19H16O |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 1-methyl-3-(4-phenylphenoxy)benzene |
| InChIKey | XKYZHTGHCYULMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)