CAS 791-92-4 is the registry number for 4-Benzhydrylphenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
4-benzhydrylphenol (CAS 791-92-4) is a chemical compound with the molecular formula C19H16O and a molecular weight of 260.3 g/mol. IUPAC name: 4-benzhydrylphenol. InChIKey: GKLBDKZKXSQUHM-UHFFFAOYSA-N.
| Molecular formula | C19H16O |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 4-benzhydrylphenol |
| InChIKey | GKLBDKZKXSQUHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)