CAS 38849-09-1 appears in our catalog under these names: Maprotiline Impurity 1(Maprotiline EP Impurity A), 9,10-Dihydro-9,10-ethanoanthracene-9-acrolein, >95% (HPLC), 3-(9,10-Ethanoanthracen-9(10H)-yl)prop-2-enal. Offered by: Hubei YoungXin, TRC, Mikromol. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(E)-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)prop-2-enal (CAS 38849-09-1) is a chemical compound with the molecular formula C19H16O and a molecular weight of 260.3 g/mol. IUPAC name: (E)-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)prop-2-enal. InChIKey: SEKAHXWZBXZWDA-VZUCSPMQSA-N.
| Molecular formula | C19H16O |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | (E)-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)prop-2-enal |
| InChIKey | SEKAHXWZBXZWDA-VZUCSPMQSA-N |
| SMILES | C1CC2(C3=CC=CC=C3C1C4=CC=CC=C42)/C=C/C=O |
Computed by PubChem (NCBI)