CAS 3881-15-0 is the registry number for Triphenyl(methanol-13C), 98% 98%atom%13C. Offered by: Chemat Brand. Available pack sizes: on request.
Triphenyl(113C)methanol (CAS 3881-15-0) is a chemical compound with the molecular formula C19H16O and a molecular weight of 261.3 g/mol. IUPAC name: triphenyl(113C)methanol. InChIKey: LZTRCELOJRDYMQ-QHPTYGIKSA-N.
| Molecular formula | C19H16O |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | triphenyl(113C)methanol |
| InChIKey | LZTRCELOJRDYMQ-QHPTYGIKSA-N |
| SMILES | C1=CC=C(C=C1)[13C](C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)