Products 3893-03-6

CAS 3893-03-6 is the registry number for 4-Methoxy-o-terphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-methoxy-4-(2-phenylphenyl)benzene (CAS 3893-03-6) is a chemical compound with the molecular formula C19H16O and a molecular weight of 260.3 g/mol. IUPAC name: 1-methoxy-4-(2-phenylphenyl)benzene. InChIKey: IRPXARHRTKAHPN-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16O
Molecular weight260.3 g/mol
IUPAC name1-methoxy-4-(2-phenylphenyl)benzene
InChIKeyIRPXARHRTKAHPN-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=CC=CC=C2C3=CC=CC=C3

Computed by PubChem (NCBI)