CAS 1545673-43-5 is the registry number for 4,4-Difluoro-3,4-dihydronaphthalen-1(2H)-one, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4,4-difluoro-2,3-dihydronaphthalen-1-one (CAS 1545673-43-5) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: 4,4-difluoro-2,3-dihydronaphthalen-1-one. InChIKey: OVELXNJTHQQMPS-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 4,4-difluoro-2,3-dihydronaphthalen-1-one |
| InChIKey | OVELXNJTHQQMPS-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1=O)(F)F |
Computed by PubChem (NCBI)