CAS 154650-22-3 appears in our catalog under these names: 2-Bromo-6-fluoro-3-methoxybenzaldehyde, 95%, 2-Bromo-6-fluoro-3-methoxybenzaldehyde 95%, 2-Bromo-6-fluoro-3-methoxybenzaldehyde, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 10g, 100mg.
2-bromo-6-fluoro-3-methoxybenzaldehyde (CAS 154650-22-3) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-bromo-6-fluoro-3-methoxybenzaldehyde. InChIKey: KJXBFVPVUAXWKZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-bromo-6-fluoro-3-methoxybenzaldehyde |
| InChIKey | KJXBFVPVUAXWKZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)C=O)Br |
Computed by PubChem (NCBI)