Products 1547593-82-7

CAS 1547593-82-7 is the registry number for 3-(Methylsulfanyl)-4-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-methylsulfanyl-4-nitrobenzoic acid (CAS 1547593-82-7) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 3-methylsulfanyl-4-nitrobenzoic acid. InChIKey: CPDDHOWMYREZAG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO4S
Molecular weight213.21 g/mol
IUPAC name3-methylsulfanyl-4-nitrobenzoic acid
InChIKeyCPDDHOWMYREZAG-UHFFFAOYSA-N
SMILESCSC1=C(C=CC(=C1)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)