CAS 1547837-22-8 is the registry number for 2-(2-Chloro-6-fluorophenyl)-2,2-difluoroacetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2-chloro-6-fluorophenyl)-2,2-difluoroacetic acid (CAS 1547837-22-8) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 2-(2-chloro-6-fluorophenyl)-2,2-difluoroacetic acid. InChIKey: JHTZCAVROIRKHO-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 2-(2-chloro-6-fluorophenyl)-2,2-difluoroacetic acid |
| InChIKey | JHTZCAVROIRKHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C(=O)O)(F)F)F |
Computed by PubChem (NCBI)