CAS 154845-34-8 appears in our catalog under these names: 3-Amino-2-naphthaldehyde, 95%, 3-Amino-2-naphthaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
3-aminonaphthalene-2-carbaldehyde (CAS 154845-34-8) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 3-aminonaphthalene-2-carbaldehyde. InChIKey: JOYPPFDDTPSWCV-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 3-aminonaphthalene-2-carbaldehyde |
| InChIKey | JOYPPFDDTPSWCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C=O)N |
Computed by PubChem (NCBI)