CAS 1549-50-4 is the registry number for N-(4-Fluorophenyl)-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (CAS 1549-50-4) is a chemical compound with the molecular formula C9H8FN5 and a molecular weight of 205.19 g/mol. IUPAC name: 2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: CGCAZIWUCXRTKW-UHFFFAOYSA-N.
| Molecular formula | C9H8FN5 |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | CGCAZIWUCXRTKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC=NC(=N2)N)F |
Computed by PubChem (NCBI)