CAS 19079-38-0 appears in our catalog under these names: N-(3-Fluorophenyl)-1,3,5-triazine-2,4-diamine, 95%, N2-(3-Fluorophenyl)-1,3,5-triazine-2,4-diamine, 95+%, N-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
2-N-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine (CAS 19079-38-0) is a chemical compound with the molecular formula C9H8FN5 and a molecular weight of 205.19 g/mol. IUPAC name: 2-N-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: JKCGOWLLLHSYBN-UHFFFAOYSA-N.
| Molecular formula | C9H8FN5 |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 2-N-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | JKCGOWLLLHSYBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)NC2=NC=NC(=N2)N |
Computed by PubChem (NCBI)