CAS 71347-59-6 appears in our catalog under these names: 6–(4–Fluorophenyl)–3–hydrazinyl–1,2,4–triazine, 6-(4-Fluorophenyl)-3-hydrazinyl-1,2,4-triazine, 95%, 6-(4-Fluorophenyl)-3-hydrazinyl-1,2,4-triazine, 95%, 95%, 6-(4-Fluorophenyl)-3-hydrazinyl-1,2,4-triazine, 97%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
[6-(4-fluorophenyl)-1,2,4-triazin-3-yl]hydrazine (CAS 71347-59-6) is a chemical compound with the molecular formula C9H8FN5 and a molecular weight of 205.19 g/mol. IUPAC name: [6-(4-fluorophenyl)-1,2,4-triazin-3-yl]hydrazine. InChIKey: FSBQFNJWWOCMJL-UHFFFAOYSA-N.
| Molecular formula | C9H8FN5 |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | [6-(4-fluorophenyl)-1,2,4-triazin-3-yl]hydrazine |
| InChIKey | FSBQFNJWWOCMJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(N=N2)NN)F |
Computed by PubChem (NCBI)