CAS 30530-44-0 appears in our catalog under these names: 2,4-Diamino-6-(4-fluorophenyl)-1,3,5-triazine, 98%, 6-(4-Fluorophenyl)-1,3,5-triazine-2,4-diamine, 97%, 2,4-Diamino-6-(4-fluorophenyl)-1,3,5-triazine, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g.
6-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (CAS 30530-44-0) is a chemical compound with the molecular formula C9H8FN5 and a molecular weight of 205.19 g/mol. IUPAC name: 6-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: UPQUQQDAZPFXCH-UHFFFAOYSA-N.
| Molecular formula | C9H8FN5 |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 6-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | UPQUQQDAZPFXCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NC(=N2)N)N)F |
Computed by PubChem (NCBI)