CAS 30530-42-8 is the registry number for 2,4-Diamino-6-(2-fluorophenyl)-1,3,5-triazine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
6-(2-fluorophenyl)-1,3,5-triazine-2,4-diamine (CAS 30530-42-8) is a chemical compound with the molecular formula C9H8FN5 and a molecular weight of 205.19 g/mol. IUPAC name: 6-(2-fluorophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: PWZNTESZSJQVGW-UHFFFAOYSA-N.
| Molecular formula | C9H8FN5 |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 6-(2-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | PWZNTESZSJQVGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NC(=N2)N)N)F |
Computed by PubChem (NCBI)