CAS 30530-43-9 appears in our catalog under these names: 2,4–Diamino–6–(3–fluorophenyl)–1,3,5–triazine, 2,4-Diamino-6-(3-fluorophenyl)-1,3,5-triazine, 98%, 98%, 1,3,5-Triazine-2,4-diamine, 6-(3-fluorophenyl)-, ≥97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
6-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine (CAS 30530-43-9) is a chemical compound with the molecular formula C9H8FN5 and a molecular weight of 205.19 g/mol. IUPAC name: 6-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: OHGKSRVADPIOLJ-UHFFFAOYSA-N.
| Molecular formula | C9H8FN5 |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 6-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | OHGKSRVADPIOLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=NC(=N2)N)N |
Computed by PubChem (NCBI)