CAS 1552-17-6 appears in our catalog under these names: 2-Nitro-5-phenoxyaniline, 97%, 97%, 2-Nitro-5-phenoxy-aniline, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 100mg, 5g.
2-nitro-5-phenoxyaniline (CAS 1552-17-6) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 2-nitro-5-phenoxyaniline. InChIKey: DYTVCSKPYOHQAE-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 2-nitro-5-phenoxyaniline |
| InChIKey | DYTVCSKPYOHQAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)