CAS 1552201-86-1 appears in our catalog under these names: 4-Fluoro-2-methylphenyl chloroformate, 95%, 4-Fluoro-2-methylphenyl chloroformate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(4-fluoro-2-methylphenyl) carbonochloridate (CAS 1552201-86-1) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: (4-fluoro-2-methylphenyl) carbonochloridate. InChIKey: XBUKKOIBVLTCOW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | (4-fluoro-2-methylphenyl) carbonochloridate |
| InChIKey | XBUKKOIBVLTCOW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)OC(=O)Cl |
Computed by PubChem (NCBI)